Products 1315366-35-8

CAS 1315366-35-8 appears in our catalog under these names: 1-Propanoyl-2,3-dihydro-1H-indole-6-sulfonyl chloride, 95%, 1-Propanoyl-2,3-dihydro-1H-indole-6-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

1-propanoyl-2,3-dihydroindole-6-sulfonyl chloride (CAS 1315366-35-8) is a chemical compound with the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. IUPAC name: 1-propanoyl-2,3-dihydroindole-6-sulfonyl chloride. InChIKey: UITHMKQIOWXCBJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12ClNO3S
Molecular weight273.74 g/mol
IUPAC name1-propanoyl-2,3-dihydroindole-6-sulfonyl chloride
InChIKeyUITHMKQIOWXCBJ-UHFFFAOYSA-N
SMILESCCC(=O)N1CCC2=C1C=C(C=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)