Products 1315376-72-7
CAS 1315376-72-7 is the registry number for (Amino(4-chlorophenyl)methylidene)amino prop-2-enoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[(Z)-[amino-(4-chlorophenyl)methylidene]amino] prop-2-enoate (CAS 1315376-72-7) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: [(Z)-[amino-(4-chlorophenyl)methylidene]amino] prop-2-enoate. InChIKey: KAHKDWZHMZKYRS-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | [(Z)-[amino-(4-chlorophenyl)methylidene]amino] prop-2-enoate |
| InChIKey | KAHKDWZHMZKYRS-UHFFFAOYSA-N |
| SMILES | C=CC(=O)O/N=C(/C1=CC=C(C=C1)Cl)\N |
Computed by PubChem (NCBI)