CAS 131724-82-8 is the registry number for Phenyl a-L-thiorhamnopyranoside. Offered by: Biosynth. Available pack sizes: 250mg, 100mg.
(2S,3R,4R,5R,6S)-2-methyl-6-phenylsulfanyloxane-3,4,5-triol (CAS 131724-82-8) is a chemical compound with the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. IUPAC name: (2S,3R,4R,5R,6S)-2-methyl-6-phenylsulfanyloxane-3,4,5-triol. InChIKey: YBOVKFRFMWFKCC-CFVLRQLYSA-N.
| Molecular formula | C12H16O4S |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | (2S,3R,4R,5R,6S)-2-methyl-6-phenylsulfanyloxane-3,4,5-triol |
| InChIKey | YBOVKFRFMWFKCC-CFVLRQLYSA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)SC2=CC=CC=C2)O)O)O |
Computed by PubChem (NCBI)