CAS 131842-77-8 appears in our catalog under these names: Bentazon-d7, >95% (HPLC), Bentazon-d7 (iso-propyl-d7), 99 atom % D, min 98% Chemical Purity, Bentazone–d7, BENTAZON-D7 PESTANAL, Bentazone-d7, 98.73%. Offered by: TRC, CDN, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 1mg, 25mg, 5mg, 0,01g, 0,005g, 10MG, 1 mg, 1x1ml.
3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2,2-dioxo-1H-2lambda6,1,3-benzothiadiazin-4-one (CAS 131842-77-8) is a chemical compound with the molecular formula C10H12N2O3S and a molecular weight of 247.32 g/mol. IUPAC name: 3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2,2-dioxo-1H-2lambda6,1,3-benzothiadiazin-4-one. InChIKey: ZOMSMJKLGFBRBS-QXMYYZBZSA-N.
| Molecular formula | C10H12N2O3S |
|---|---|
| Molecular weight | 247.32 g/mol |
| IUPAC name | 3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2,2-dioxo-1H-2lambda6,1,3-benzothiadiazin-4-one |
| InChIKey | ZOMSMJKLGFBRBS-QXMYYZBZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])N1C(=O)C2=CC=CC=C2NS1(=O)=O |
Computed by PubChem (NCBI)