Products 1330188-66-3
CAS 1330188-66-3 is the registry number for Bentazon-13C6. Offered by: TRC. Available pack sizes: 25mg.
2,2-dioxo-3-propan-2-yl-1H-2lambda6,1,3-benzothiadiazin-4-one (CAS 1330188-66-3) is a chemical compound with the molecular formula C10H12N2O3S and a molecular weight of 246.24 g/mol. IUPAC name: 2,2-dioxo-3-propan-2-yl-1H-2lambda6,1,3-benzothiadiazin-4-one. InChIKey: ZOMSMJKLGFBRBS-CICUYXHZSA-N.
| Molecular formula | C10H12N2O3S |
|---|---|
| Molecular weight | 246.24 g/mol |
| IUPAC name | 2,2-dioxo-3-propan-2-yl-1H-2lambda6,1,3-benzothiadiazin-4-one |
| InChIKey | ZOMSMJKLGFBRBS-CICUYXHZSA-N |
| SMILES | CC(C)N1C(=O)[13C]2=[13CH][13CH]=[13CH][13CH]=[13C]2NS1(=O)=O |
Computed by PubChem (NCBI)