CAS 1319196-92-3 appears in our catalog under these names: 2–Bromo–5–fluoro–3–methylbenzoic acid, 2-Bromo-5-fluoro-3-methylbenzoic acid, 98%, 2-Bromo-5-fluoro-3-methylbenzoic acid 95%, 2-Bromo-5-fluoro-3-methylbenzoic acid, 95%, 2-Bromo-5-fluoro-3-methylbenzoic acid, 95%, 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 5g, 250mg.
2-bromo-5-fluoro-3-methylbenzoic acid (CAS 1319196-92-3) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-bromo-5-fluoro-3-methylbenzoic acid. InChIKey: XPSSOXATQWMSLY-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-bromo-5-fluoro-3-methylbenzoic acid |
| InChIKey | XPSSOXATQWMSLY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C(=O)O)F |
Computed by PubChem (NCBI)