Products 131998-24-8
CAS 131998-24-8 appears in our catalog under these names: 5,7-Dichloro-1,8-naphthyridin-2-amine, 95%, 5，7–Dichloro–1，8–naphthyridin–2–amine, 5,7-Dichloro-1,8-naphthyridin-2-amine, ≥95%, ≥95%, 5,7-Dichloro-1,8-naphthyridin-2-amine, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
5,7-dichloro-1,8-naphthyridin-2-amine (CAS 131998-24-8) is a chemical compound with the molecular formula C8H5Cl2N3 and a molecular weight of 214.05 g/mol. IUPAC name: 5,7-dichloro-1,8-naphthyridin-2-amine. InChIKey: NEAYOFOFEATUKC-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3 |
|---|---|
| Molecular weight | 214.05 g/mol |
| IUPAC name | 5,7-dichloro-1,8-naphthyridin-2-amine |
| InChIKey | NEAYOFOFEATUKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=CC(=N2)Cl)Cl)N |
Computed by PubChem (NCBI)