CAS 2365420-03-5 appears in our catalog under these names: 5,6-Dichloroquinazolin-2-amine, 96%, 5,6-Dichloroquinazolin-2-amine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.
5,6-dichloroquinazolin-2-amine (CAS 2365420-03-5) is a chemical compound with the molecular formula C8H5Cl2N3 and a molecular weight of 214.05 g/mol. IUPAC name: 5,6-dichloroquinazolin-2-amine. InChIKey: OQCWWVSLJJQMKX-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3 |
|---|---|
| Molecular weight | 214.05 g/mol |
| IUPAC name | 5,6-dichloroquinazolin-2-amine |
| InChIKey | OQCWWVSLJJQMKX-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=NC=C2C(=C1Cl)Cl)N |
Computed by PubChem (NCBI)