CAS 2322695-59-8 is the registry number for 5-(2,4-Dichlorophenyl)-1H-1,2,4-triazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,4-dichlorophenyl)-1H-1,2,4-triazole (CAS 2322695-59-8) is a chemical compound with the molecular formula C8H5Cl2N3 and a molecular weight of 214.05 g/mol. IUPAC name: 5-(2,4-dichlorophenyl)-1H-1,2,4-triazole. InChIKey: VJTLMIUGZJEMLF-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3 |
|---|---|
| Molecular weight | 214.05 g/mol |
| IUPAC name | 5-(2,4-dichlorophenyl)-1H-1,2,4-triazole |
| InChIKey | VJTLMIUGZJEMLF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=NC=NN2 |
Computed by PubChem (NCBI)