CAS 369363-72-4 is the registry number for 4-(2,4-Dichlorophenyl)-1H-1,2,3-triazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,4-dichlorophenyl)-2H-triazole (CAS 369363-72-4) is a chemical compound with the molecular formula C8H5Cl2N3 and a molecular weight of 214.05 g/mol. IUPAC name: 4-(2,4-dichlorophenyl)-2H-triazole. InChIKey: QYLJFWSVVYNACL-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3 |
|---|---|
| Molecular weight | 214.05 g/mol |
| IUPAC name | 4-(2,4-dichlorophenyl)-2H-triazole |
| InChIKey | QYLJFWSVVYNACL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=NNN=C2 |
Computed by PubChem (NCBI)