CAS 1379308-14-1 is the registry number for 4,5-Dichloroquinazolin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4,5-dichloroquinazolin-2-amine (CAS 1379308-14-1) is a chemical compound with the molecular formula C8H5Cl2N3 and a molecular weight of 214.05 g/mol. IUPAC name: 4,5-dichloroquinazolin-2-amine. InChIKey: QLEMYPFWFAXCLJ-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3 |
|---|---|
| Molecular weight | 214.05 g/mol |
| IUPAC name | 4,5-dichloroquinazolin-2-amine |
| InChIKey | QLEMYPFWFAXCLJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=NC(=N2)N)Cl |
Computed by PubChem (NCBI)