CAS 2654746-98-0 is the registry number for 1,7-Dichloro-4-methylpyrido[3,4-d]pyridazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,7-dichloro-4-methylpyrido[3,4-d]pyridazine (CAS 2654746-98-0) is a chemical compound with the molecular formula C8H5Cl2N3 and a molecular weight of 214.05 g/mol. IUPAC name: 1,7-dichloro-4-methylpyrido[3,4-d]pyridazine. InChIKey: FMRFVRJBSXPUOU-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3 |
|---|---|
| Molecular weight | 214.05 g/mol |
| IUPAC name | 1,7-dichloro-4-methylpyrido[3,4-d]pyridazine |
| InChIKey | FMRFVRJBSXPUOU-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(C2=CC(=NC=C12)Cl)Cl |
Computed by PubChem (NCBI)