Products 1320346-14-2
CAS 1320346-14-2 is the registry number for IP2015. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-3-methoxychromen-2-one (CAS 1320346-14-2) is a chemical compound with the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. IUPAC name: 7-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-3-methoxychromen-2-one. InChIKey: JCRMWMMEWIZRMN-ONXXMXGDSA-N.
| Molecular formula | C17H19NO4 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | 7-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-3-methoxychromen-2-one |
| InChIKey | JCRMWMMEWIZRMN-ONXXMXGDSA-N |
| SMILES | COC1=CC2=C(C=C(C=C2)OC3C[C@H]4CC[C@@H](C3)N4)OC1=O |
Computed by PubChem (NCBI)