CAS 132257-69-3 is the registry number for 4,4'-[Naphthalene-2,7-diylbis(oxy)]dianiline, >98.0%(HPLC)(T). Offered by: TCI. Available pack sizes: 1g, 5g.
4-[7-(4-aminophenoxy)naphthalen-2-yl]oxyaniline (CAS 132257-69-3) is a chemical compound with the molecular formula C22H18N2O2 and a molecular weight of 342.4 g/mol. IUPAC name: 4-[7-(4-aminophenoxy)naphthalen-2-yl]oxyaniline. InChIKey: NGHVXWLOTSZENC-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O2 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 4-[7-(4-aminophenoxy)naphthalen-2-yl]oxyaniline |
| InChIKey | NGHVXWLOTSZENC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=C2)OC3=CC=C(C=C3)N)OC4=CC=C(C=C4)N |
Computed by PubChem (NCBI)