CAS 13228-40-5 appears in our catalog under these names: 2–(2–Pyridyl)indole, 2-(2-Pyridyl)indole, >97.0%(GC), 2-(2-Pyridyl)indole 98%, 2-(2-Pyridyl)indole, 98%, 98%, 2-(2-Pyridinyl)-1H-indole, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 200mg, 500mg, 100mg, 250mg, 5g.
2-pyridin-2-yl-1H-indole (CAS 13228-40-5) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 2-pyridin-2-yl-1H-indole. InChIKey: OLGGLCIDAMICTA-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-pyridin-2-yl-1H-indole |
| InChIKey | OLGGLCIDAMICTA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)