Products 132376-92-2
CAS 132376-92-2 is the registry number for Thymidine-d2. Offered by: MedChemExpress. Available pack sizes: 100 mg, 50 mg.
1-[(2R,4S,5R)-5-[dideuterio(hydroxy)methyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 132376-92-2) is a chemical compound with the molecular formula C10H14N2O5 and a molecular weight of 244.24 g/mol. IUPAC name: 1-[(2R,4S,5R)-5-[dideuterio(hydroxy)methyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: IQFYYKKMVGJFEH-PQDUBQKDSA-N.
| Molecular formula | C10H14N2O5 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-5-[dideuterio(hydroxy)methyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | IQFYYKKMVGJFEH-PQDUBQKDSA-N |
| SMILES | [2H]C([2H])([C@@H]1[C@H](C[C@@H](O1)N2C=C(C(=O)NC2=O)C)O)O |
Computed by PubChem (NCBI)