CAS 1324054-30-9 is the registry number for S-(Azetidin-3-yl) benzothioate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
S-(azetidin-3-yl) benzenecarbothioate (CAS 1324054-30-9) is a chemical compound with the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. IUPAC name: S-(azetidin-3-yl) benzenecarbothioate. InChIKey: LJHSAPMBLGPZTB-UHFFFAOYSA-N.
| Molecular formula | C10H11NOS |
|---|---|
| Molecular weight | 193.27 g/mol |
| IUPAC name | S-(azetidin-3-yl) benzenecarbothioate |
| InChIKey | LJHSAPMBLGPZTB-UHFFFAOYSA-N |
| SMILES | C1C(CN1)SC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)