Products 1324054-30-9

CAS 1324054-30-9 is the registry number for S-(Azetidin-3-yl) benzothioate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

S-(azetidin-3-yl) benzenecarbothioate (CAS 1324054-30-9) is a chemical compound with the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. IUPAC name: S-(azetidin-3-yl) benzenecarbothioate. InChIKey: LJHSAPMBLGPZTB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NOS
Molecular weight193.27 g/mol
IUPAC nameS-(azetidin-3-yl) benzenecarbothioate
InChIKeyLJHSAPMBLGPZTB-UHFFFAOYSA-N
SMILESC1C(CN1)SC(=O)C2=CC=CC=C2

Computed by PubChem (NCBI)