CAS 1326308-94-4 appears in our catalog under these names: (2-Fluorophenyl)methyl chloroformate, 95%, (2-Fluorophenyl)methyl chloroformate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
(2-fluorophenyl)methyl carbonochloridate (CAS 1326308-94-4) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: (2-fluorophenyl)methyl carbonochloridate. InChIKey: OGXKEDVRAWFRHJ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | (2-fluorophenyl)methyl carbonochloridate |
| InChIKey | OGXKEDVRAWFRHJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC(=O)Cl)F |
Computed by PubChem (NCBI)