CAS 132867-76-6 is the registry number for 1,2,3-Tri-o-benzoyl-alpha-l-fucopyranose, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
[(2S,3S,4R,5R,6S)-2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl] benzoate (CAS 132867-76-6) is a chemical compound with the molecular formula C27H24O8 and a molecular weight of 476.5 g/mol. IUPAC name: [(2S,3S,4R,5R,6S)-2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl] benzoate. InChIKey: KQGJMQCLDRXSBI-FKQKUNFOSA-N.
| Molecular formula | C27H24O8 |
|---|---|
| Molecular weight | 476.5 g/mol |
| IUPAC name | [(2S,3S,4R,5R,6S)-2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl] benzoate |
| InChIKey | KQGJMQCLDRXSBI-FKQKUNFOSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)OC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)O |
Computed by PubChem (NCBI)