Products 30361-17-2
CAS 30361-17-2 appears in our catalog under these names: (3R,4R,5R)-5-((Benzoyloxy)methyl)-2-hydroxy-3-methyltetrahydrofuran-3,4-diyl dibenzoate, 98+%, 2,3,5-Tri-O-benzoyl-2-C-methyl-D-ribofuranose. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 100g, 50g, 250g, 500g.
[(2R,3R,4R)-3,4-dibenzoyloxy-5-hydroxy-4-methyloxolan-2-yl]methyl benzoate (CAS 30361-17-2) is a chemical compound with the molecular formula C27H24O8 and a molecular weight of 476.5 g/mol. IUPAC name: [(2R,3R,4R)-3,4-dibenzoyloxy-5-hydroxy-4-methyloxolan-2-yl]methyl benzoate. InChIKey: NGOREDWQTFTUTC-KXGJQKBVSA-N.
| Molecular formula | C27H24O8 |
|---|---|
| Molecular weight | 476.5 g/mol |
| IUPAC name | [(2R,3R,4R)-3,4-dibenzoyloxy-5-hydroxy-4-methyloxolan-2-yl]methyl benzoate |
| InChIKey | NGOREDWQTFTUTC-KXGJQKBVSA-N |
| SMILES | C[C@]1([C@@H]([C@H](OC1O)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)