CAS 16434-48-3 is the registry number for (2R,3R,4R,5R)-5-((Benzoyloxy)methyl)-3-hydroxy-3-methyltetrahydrofuran-2,4-diyl dibenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4R,5R)-3,5-dibenzoyloxy-4-hydroxy-4-methyloxolan-2-yl]methyl benzoate (CAS 16434-48-3) is a chemical compound with the molecular formula C27H24O8 and a molecular weight of 476.5 g/mol. IUPAC name: [(2R,3R,4R,5R)-3,5-dibenzoyloxy-4-hydroxy-4-methyloxolan-2-yl]methyl benzoate. InChIKey: ZPFLNAMPENZJSE-IKAXQFJBSA-N.
| Molecular formula | C27H24O8 |
|---|---|
| Molecular weight | 476.5 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3,5-dibenzoyloxy-4-hydroxy-4-methyloxolan-2-yl]methyl benzoate |
| InChIKey | ZPFLNAMPENZJSE-IKAXQFJBSA-N |
| SMILES | C[C@]1([C@@H]([C@H](O[C@@H]1OC(=O)C2=CC=CC=C2)COC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)O |
Computed by PubChem (NCBI)