Products 10225-78-2
CAS 10225-78-2 is the registry number for (2S,3R,4S,5R)-2-Methoxytetrahydro-2H-pyran-3,4,5-triyl tribenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3R,4S,5R,6S)-4,5-dibenzoyloxy-6-methoxyoxan-3-yl] benzoate (CAS 10225-78-2) is a chemical compound with the molecular formula C27H24O8 and a molecular weight of 476.5 g/mol. IUPAC name: [(3R,4S,5R,6S)-4,5-dibenzoyloxy-6-methoxyoxan-3-yl] benzoate. InChIKey: BMICZGNBUCUNFZ-IDIXZGLXSA-N.
| Molecular formula | C27H24O8 |
|---|---|
| Molecular weight | 476.5 g/mol |
| IUPAC name | [(3R,4S,5R,6S)-4,5-dibenzoyloxy-6-methoxyoxan-3-yl] benzoate |
| InChIKey | BMICZGNBUCUNFZ-IDIXZGLXSA-N |
| SMILES | CO[C@@H]1[C@@H]([C@H]([C@@H](CO1)OC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)