Products 199794-14-4
CAS 199794-14-4 is the registry number for Methyl 2,3,5-tri-o-benzoyl-beta-d-arabinofuranoside, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[(2R,3R,4S,5R)-3,4-dibenzoyloxy-5-methoxyoxolan-2-yl]methyl benzoate (CAS 199794-14-4) is a chemical compound with the molecular formula C27H24O8 and a molecular weight of 476.5 g/mol. IUPAC name: [(2R,3R,4S,5R)-3,4-dibenzoyloxy-5-methoxyoxolan-2-yl]methyl benzoate. InChIKey: XJKNQPQTQXKNOC-IQXSCUCBSA-N.
| Molecular formula | C27H24O8 |
|---|---|
| Molecular weight | 476.5 g/mol |
| IUPAC name | [(2R,3R,4S,5R)-3,4-dibenzoyloxy-5-methoxyoxolan-2-yl]methyl benzoate |
| InChIKey | XJKNQPQTQXKNOC-IQXSCUCBSA-N |
| SMILES | CO[C@H]1[C@H]([C@@H]([C@H](O1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)