CAS 7494-44-2 appears in our catalog under these names: 2,3,4-Tri-o-benzoyl-beta-L-rhamnopyranose, 95%, 2,3,4-TRIBENZOYL-L-RHAMNOPYRANOSE. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 1G.
(4,5-dibenzoyloxy-6-hydroxy-2-methyloxan-3-yl) benzoate (CAS 7494-44-2) is a chemical compound with the molecular formula C27H24O8 and a molecular weight of 476.5 g/mol. IUPAC name: (4,5-dibenzoyloxy-6-hydroxy-2-methyloxan-3-yl) benzoate. InChIKey: UTEZHORWKBBBND-UHFFFAOYSA-N.
| Molecular formula | C27H24O8 |
|---|---|
| Molecular weight | 476.5 g/mol |
| IUPAC name | (4,5-dibenzoyloxy-6-hydroxy-2-methyloxan-3-yl) benzoate |
| InChIKey | UTEZHORWKBBBND-UHFFFAOYSA-N |
| SMILES | CC1C(C(C(C(O1)O)OC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)