Products 1329614-73-4
CAS 1329614-73-4 is the registry number for 3–Acetylbenzophenone–d5. Offered by: GLPBio. Available pack sizes: 50mg.
1-[3-(2,3,4,5,6-pentadeuteriobenzoyl)phenyl]ethanone (CAS 1329614-73-4) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 229.28 g/mol. IUPAC name: 1-[3-(2,3,4,5,6-pentadeuteriobenzoyl)phenyl]ethanone. InChIKey: PPNGALBGZJBTRY-QRKCWBMQSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 229.28 g/mol |
| IUPAC name | 1-[3-(2,3,4,5,6-pentadeuteriobenzoyl)phenyl]ethanone |
| InChIKey | PPNGALBGZJBTRY-QRKCWBMQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)C2=CC=CC(=C2)C(=O)C)[2H])[2H] |
Computed by PubChem (NCBI)