Products 1329792-44-0
CAS 1329792-44-0 is the registry number for 5-Amino-2-cyanobenzotrifluoride-d3. Offered by: TRC. Available pack sizes: 50mg, 5mg.
4-amino-2,3,5-trideuterio-6-(trifluoromethyl)benzonitrile (CAS 1329792-44-0) is a chemical compound with the molecular formula C8H5F3N2 and a molecular weight of 189.15 g/mol. IUPAC name: 4-amino-2,3,5-trideuterio-6-(trifluoromethyl)benzonitrile. InChIKey: PMDYLCUKSLBUHO-CBYSEHNBSA-N.
| Molecular formula | C8H5F3N2 |
|---|---|
| Molecular weight | 189.15 g/mol |
| IUPAC name | 4-amino-2,3,5-trideuterio-6-(trifluoromethyl)benzonitrile |
| InChIKey | PMDYLCUKSLBUHO-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C#N)C(F)(F)F)[2H])N)[2H] |
Computed by PubChem (NCBI)