Products 1330185-26-6
CAS 1330185-26-6 appears in our catalog under these names: Dapsone Hydroxylamine-d4, >95% (HPLC), Dapsone hydroxylamine-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
N-[4-(4-amino-2,3,5,6-tetradeuteriophenyl)sulfonylphenyl]hydroxylamine (CAS 1330185-26-6) is a chemical compound with the molecular formula C12H12N2O3S and a molecular weight of 268.33 g/mol. IUPAC name: N-[4-(4-amino-2,3,5,6-tetradeuteriophenyl)sulfonylphenyl]hydroxylamine. InChIKey: IYDSJDWESCGRKW-NMRLXUNGSA-N.
| Molecular formula | C12H12N2O3S |
|---|---|
| Molecular weight | 268.33 g/mol |
| IUPAC name | N-[4-(4-amino-2,3,5,6-tetradeuteriophenyl)sulfonylphenyl]hydroxylamine |
| InChIKey | IYDSJDWESCGRKW-NMRLXUNGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])S(=O)(=O)C2=CC=C(C=C2)NO)[2H] |
Computed by PubChem (NCBI)