CAS 1330186-53-2 is the registry number for 1-(2,3-Dimethoxyphenyl)-1-tosylmethyl isocyanide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1-[isocyano-(4-methylphenyl)sulfonylmethyl]-2,3-dimethoxybenzene (CAS 1330186-53-2) is a chemical compound with the molecular formula C17H17NO4S and a molecular weight of 331.4 g/mol. IUPAC name: 1-[isocyano-(4-methylphenyl)sulfonylmethyl]-2,3-dimethoxybenzene. InChIKey: AVQXJHWREIZUKB-UHFFFAOYSA-N.
| Molecular formula | C17H17NO4S |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 1-[isocyano-(4-methylphenyl)sulfonylmethyl]-2,3-dimethoxybenzene |
| InChIKey | AVQXJHWREIZUKB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2=C(C(=CC=C2)OC)OC)[N+]#[C-] |
Computed by PubChem (NCBI)