CAS 139122-20-6 appears in our catalog under these names: 4-[2-[[(4-Methylphenyl)sulfonyl]oxy]ethyl]-2-oxoindole, 95%, 2-(2-Oxoindolin-4-yl)ethyl 4-methylbenzenesulfonate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-(2-oxo-1,3-dihydroindol-4-yl)ethyl 4-methylbenzenesulfonate (CAS 139122-20-6) is a chemical compound with the molecular formula C17H17NO4S and a molecular weight of 331.4 g/mol. IUPAC name: 2-(2-oxo-1,3-dihydroindol-4-yl)ethyl 4-methylbenzenesulfonate. InChIKey: OGFUVAXFYGBCAK-UHFFFAOYSA-N.
| Molecular formula | C17H17NO4S |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 2-(2-oxo-1,3-dihydroindol-4-yl)ethyl 4-methylbenzenesulfonate |
| InChIKey | OGFUVAXFYGBCAK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCC2=C3CC(=O)NC3=CC=C2 |
Computed by PubChem (NCBI)