CAS 731797-76-5 is the registry number for 3-((1,2,3,4-Tetrahydronaphthalen-1-yl)sulfamoyl)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoyl)benzoic acid (CAS 731797-76-5) is a chemical compound with the molecular formula C17H17NO4S and a molecular weight of 331.4 g/mol. IUPAC name: 3-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoyl)benzoic acid. InChIKey: YNMDTZTUYCWFAX-UHFFFAOYSA-N.
| Molecular formula | C17H17NO4S |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 3-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoyl)benzoic acid |
| InChIKey | YNMDTZTUYCWFAX-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C2C1)NS(=O)(=O)C3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)