CAS 1858242-04-2 is the registry number for (9-Isopropyl-5,5-dioxido-6h-dibenzo[c,e][1,2]thiazin-6-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(5,5-dioxo-9-propan-2-ylbenzo[c][1,2]benzothiazin-6-yl)acetic acid (CAS 1858242-04-2) is a chemical compound with the molecular formula C17H17NO4S and a molecular weight of 331.4 g/mol. IUPAC name: 2-(5,5-dioxo-9-propan-2-ylbenzo[c][1,2]benzothiazin-6-yl)acetic acid. InChIKey: XWXRNPULSQYGII-UHFFFAOYSA-N.
| Molecular formula | C17H17NO4S |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 2-(5,5-dioxo-9-propan-2-ylbenzo[c][1,2]benzothiazin-6-yl)acetic acid |
| InChIKey | XWXRNPULSQYGII-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(C=C1)N(S(=O)(=O)C3=CC=CC=C32)CC(=O)O |
Computed by PubChem (NCBI)