CAS 943614-50-4 is the registry number for 4-[Isocyano-(toluene-4-sulfonyl)-methyl]-1,2-dimethoxy-benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10G, 250mg.
4-[isocyano-(4-methylphenyl)sulfonylmethyl]-1,2-dimethoxybenzene (CAS 943614-50-4) is a chemical compound with the molecular formula C17H17NO4S and a molecular weight of 331.4 g/mol. IUPAC name: 4-[isocyano-(4-methylphenyl)sulfonylmethyl]-1,2-dimethoxybenzene. InChIKey: BBHGJASHMFZDSX-UHFFFAOYSA-N.
| Molecular formula | C17H17NO4S |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 4-[isocyano-(4-methylphenyl)sulfonylmethyl]-1,2-dimethoxybenzene |
| InChIKey | BBHGJASHMFZDSX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2=CC(=C(C=C2)OC)OC)[N+]#[C-] |
Computed by PubChem (NCBI)