Products 749219-12-3
CAS 749219-12-3 is the registry number for 2-(4-Methoxybenzamido)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-[(4-methoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid (CAS 749219-12-3) is a chemical compound with the molecular formula C17H17NO4S and a molecular weight of 331.4 g/mol. IUPAC name: 2-[(4-methoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid. InChIKey: FOXADHJEWCJTGJ-UHFFFAOYSA-N.
| Molecular formula | C17H17NO4S |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 2-[(4-methoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid |
| InChIKey | FOXADHJEWCJTGJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)NC2=C(C3=C(S2)CCCC3)C(=O)O |
Computed by PubChem (NCBI)