CAS 1332-94-1 is the registry number for Laetrile. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S,3S,4S,5R,6R)-6-[(R)-cyano(phenyl)methoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 1332-94-1) is a chemical compound with the molecular formula C14H15NO7 and a molecular weight of 309.27 g/mol. IUPAC name: (2S,3S,4S,5R,6R)-6-[(R)-cyano(phenyl)methoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: XLSLFPQAPYONPW-WHUHBCJBSA-N.
| Molecular formula | C14H15NO7 |
|---|---|
| Molecular weight | 309.27 g/mol |
| IUPAC name | (2S,3S,4S,5R,6R)-6-[(R)-cyano(phenyl)methoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | XLSLFPQAPYONPW-WHUHBCJBSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C#N)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O |
Computed by PubChem (NCBI)