CAS 540791-94-4 is the registry number for dimethyl-5-((2-carboxyethyl)carbonylamino)-isophthalate. Offered by: Biosynth. Available pack sizes: 250mg.
4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobutanoic acid (CAS 540791-94-4) is a chemical compound with the molecular formula C14H15NO7 and a molecular weight of 309.27 g/mol. IUPAC name: 4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobutanoic acid. InChIKey: PPUVMTUBSOPBLA-UHFFFAOYSA-N.
| Molecular formula | C14H15NO7 |
|---|---|
| Molecular weight | 309.27 g/mol |
| IUPAC name | 4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobutanoic acid |
| InChIKey | PPUVMTUBSOPBLA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)NC(=O)CCC(=O)O)C(=O)OC |
Computed by PubChem (NCBI)