CAS 1332329-90-4 is the registry number for (S)-Chloromethyl 2-((methoxycarbonyl)amino)-3-methylbutanoate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Chloromethyl (2S)-2-(methoxycarbonylamino)-3-methylbutanoate (CAS 1332329-90-4) is a chemical compound with the molecular formula C8H14ClNO4 and a molecular weight of 223.65 g/mol. IUPAC name: chloromethyl (2S)-2-(methoxycarbonylamino)-3-methylbutanoate. InChIKey: BOBMMJJMRLKXID-LURJTMIESA-N.
| Molecular formula | C8H14ClNO4 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | chloromethyl (2S)-2-(methoxycarbonylamino)-3-methylbutanoate |
| InChIKey | BOBMMJJMRLKXID-LURJTMIESA-N |
| SMILES | CC(C)[C@@H](C(=O)OCCl)NC(=O)OC |
Computed by PubChem (NCBI)