CAS 2230798-76-0 is the registry number for 1,3-Dimethyl 1-aminocyclobutane-1,3-dicarboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Dimethyl 1-aminocyclobutane-1,3-dicarboxylate;hydrochloride (CAS 2230798-76-0) is a chemical compound with the molecular formula C8H14ClNO4 and a molecular weight of 223.65 g/mol. IUPAC name: dimethyl 1-aminocyclobutane-1,3-dicarboxylate;hydrochloride. InChIKey: HKRVWCZPRPGIRC-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNO4 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | dimethyl 1-aminocyclobutane-1,3-dicarboxylate;hydrochloride |
| InChIKey | HKRVWCZPRPGIRC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC(C1)(C(=O)OC)N.Cl |
Computed by PubChem (NCBI)