Products 2230798-76-0

CAS 2230798-76-0 is the registry number for 1,3-Dimethyl 1-aminocyclobutane-1,3-dicarboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Dimethyl 1-aminocyclobutane-1,3-dicarboxylate;hydrochloride (CAS 2230798-76-0) is a chemical compound with the molecular formula C8H14ClNO4 and a molecular weight of 223.65 g/mol. IUPAC name: dimethyl 1-aminocyclobutane-1,3-dicarboxylate;hydrochloride. InChIKey: HKRVWCZPRPGIRC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14ClNO4
Molecular weight223.65 g/mol
IUPAC namedimethyl 1-aminocyclobutane-1,3-dicarboxylate;hydrochloride
InChIKeyHKRVWCZPRPGIRC-UHFFFAOYSA-N
SMILESCOC(=O)C1CC(C1)(C(=O)OC)N.Cl

Computed by PubChem (NCBI)