CAS 86958-48-7 is the registry number for 2-(2-Chloro-2-nitropropoxy)tetrahydro-2H-pyran. Offered by: TRC. Available pack sizes: 100mg, 1g.
2-(2-chloro-2-nitropropoxy)oxane (CAS 86958-48-7) is a chemical compound with the molecular formula C8H14ClNO4 and a molecular weight of 223.65 g/mol. IUPAC name: 2-(2-chloro-2-nitropropoxy)oxane. InChIKey: XXIXCGZPUSLGPY-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNO4 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 2-(2-chloro-2-nitropropoxy)oxane |
| InChIKey | XXIXCGZPUSLGPY-UHFFFAOYSA-N |
| SMILES | CC(COC1CCCCO1)([N+](=O)[O-])Cl |
Computed by PubChem (NCBI)