CAS 71404-98-3 appears in our catalog under these names: Boc-beta-chloro-ala-oh, 95%, Boc–β–chloro–Ala–OH, Boc-β-Cl-Ala-OH 95%, (R)-2-((tert-Butoxycarbonyl)amino)-3-chloropropanoic acid, 97%, 97%, BOC-BETA-CHLORO-ALA-OH, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg.
(2R)-3-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 71404-98-3) is a chemical compound with the molecular formula C8H14ClNO4 and a molecular weight of 223.65 g/mol. IUPAC name: (2R)-3-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: NMRCVEILBKVWIK-YFKPBYRVSA-N.
| Molecular formula | C8H14ClNO4 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | (2R)-3-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | NMRCVEILBKVWIK-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCl)C(=O)O |
Computed by PubChem (NCBI)