Products 2375274-20-5

CAS 2375274-20-5 is the registry number for 3,3-Dimethyl pyrrolidine-3,3-dicarboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Dimethyl pyrrolidine-3,3-dicarboxylate;hydrochloride (CAS 2375274-20-5) is a chemical compound with the molecular formula C8H14ClNO4 and a molecular weight of 223.65 g/mol. IUPAC name: dimethyl pyrrolidine-3,3-dicarboxylate;hydrochloride. InChIKey: OZBSEPAEKNICIO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14ClNO4
Molecular weight223.65 g/mol
IUPAC namedimethyl pyrrolidine-3,3-dicarboxylate;hydrochloride
InChIKeyOZBSEPAEKNICIO-UHFFFAOYSA-N
SMILESCOC(=O)C1(CCNC1)C(=O)OC.Cl

Computed by PubChem (NCBI)