CAS 2361608-85-5 is the registry number for 2-((3R,5S)-5-(Methoxycarbonyl)pyrrolidin-3-yl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(3R,5S)-5-methoxycarbonylpyrrolidin-3-yl]acetic acid;hydrochloride (CAS 2361608-85-5) is a chemical compound with the molecular formula C8H14ClNO4 and a molecular weight of 223.65 g/mol. IUPAC name: 2-[(3R,5S)-5-methoxycarbonylpyrrolidin-3-yl]acetic acid;hydrochloride. InChIKey: ZEEYFIFKRSTVLW-IBTYICNHSA-N.
| Molecular formula | C8H14ClNO4 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 2-[(3R,5S)-5-methoxycarbonylpyrrolidin-3-yl]acetic acid;hydrochloride |
| InChIKey | ZEEYFIFKRSTVLW-IBTYICNHSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H](CN1)CC(=O)O.Cl |
Computed by PubChem (NCBI)