Products 13324-94-2
CAS 13324-94-2 is the registry number for 4,6-Diaminobenzene-1,3-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 0,05g, 0,1g, 0,25g, 0,5g, 1g.
4,6-diaminobenzene-1,3-dicarboxylic acid (CAS 13324-94-2) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: 4,6-diaminobenzene-1,3-dicarboxylic acid. InChIKey: ILPDVOFDSNNCNY-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 4,6-diaminobenzene-1,3-dicarboxylic acid |
| InChIKey | ILPDVOFDSNNCNY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1C(=O)O)N)N)C(=O)O |
Computed by PubChem (NCBI)