Products 1332765-90-8
CAS 1332765-90-8 is the registry number for 3-(2-Chlorophenyl)oxetan-3-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
3-(2-chlorophenyl)oxetan-3-amine;hydrochloride (CAS 1332765-90-8) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: 3-(2-chlorophenyl)oxetan-3-amine;hydrochloride. InChIKey: OGMFLQRDZVDHMT-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | 3-(2-chlorophenyl)oxetan-3-amine;hydrochloride |
| InChIKey | OGMFLQRDZVDHMT-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=CC=CC=C2Cl)N.Cl |
Computed by PubChem (NCBI)