CAS 28814-72-4 is the registry number for cis-3,6-Bis(2-hydroxyethyl)piperazine-2,5-dione, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
(3S,6S)-3,6-bis(2-hydroxyethyl)piperazine-2,5-dione (CAS 28814-72-4) is a chemical compound with the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. IUPAC name: (3S,6S)-3,6-bis(2-hydroxyethyl)piperazine-2,5-dione. InChIKey: YCISBBFTTVKSNK-WDSKDSINSA-N.
| Molecular formula | C8H14N2O4 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | (3S,6S)-3,6-bis(2-hydroxyethyl)piperazine-2,5-dione |
| InChIKey | YCISBBFTTVKSNK-WDSKDSINSA-N |
| SMILES | C(CO)[C@H]1C(=O)N[C@H](C(=O)N1)CCO |
Computed by PubChem (NCBI)