CAS 1334147-20-4 appears in our catalog under these names: 3-Nitro-1-N-((2,4,6-trimethylphenyl)methyl)benzene-1,4-diamine, 95%, 3-Nitro-1-N-((2,4,6-trimethylphenyl)methyl)benzene-1,4-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-nitro-4-N-[(2,4,6-trimethylphenyl)methyl]benzene-1,4-diamine (CAS 1334147-20-4) is a chemical compound with the molecular formula C16H19N3O2 and a molecular weight of 285.34 g/mol. IUPAC name: 2-nitro-4-N-[(2,4,6-trimethylphenyl)methyl]benzene-1,4-diamine. InChIKey: OPHUVZDLTOOXTM-UHFFFAOYSA-N.
| Molecular formula | C16H19N3O2 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | 2-nitro-4-N-[(2,4,6-trimethylphenyl)methyl]benzene-1,4-diamine |
| InChIKey | OPHUVZDLTOOXTM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)CNC2=CC(=C(C=C2)N)[N+](=O)[O-])C |
Computed by PubChem (NCBI)