CAS 2518343-21-8 appears in our catalog under these names: Zolmitriptan Impurity 8, Zolmitriptan Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-4-[(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl)methyl]-1,3-oxazolidin-2-one (CAS 2518343-21-8) is a chemical compound with the molecular formula C16H19N3O2 and a molecular weight of 285.34 g/mol. IUPAC name: (4S)-4-[(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl)methyl]-1,3-oxazolidin-2-one. InChIKey: LYAXZOXNFLQOAA-NSHDSACASA-N.
| Molecular formula | C16H19N3O2 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | (4S)-4-[(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl)methyl]-1,3-oxazolidin-2-one |
| InChIKey | LYAXZOXNFLQOAA-NSHDSACASA-N |
| SMILES | CN1CCC2=C(C1)NC3=C2C=C(C=C3)C[C@H]4COC(=O)N4 |
Computed by PubChem (NCBI)