CAS 3032026-54-0 is the registry number for (R)-N-(4-aminophenethyl)-N-(2-hydroxy-2-phenylethyl)nitrous amide. Offered by: TRC. Available pack sizes: 10mg, 50mg.
N-[2-(4-aminophenyl)ethyl]-N-[(2R)-2-hydroxy-2-phenylethyl]nitrous amide (CAS 3032026-54-0) is a chemical compound with the molecular formula C16H19N3O2 and a molecular weight of 285.34 g/mol. IUPAC name: N-[2-(4-aminophenyl)ethyl]-N-[(2R)-2-hydroxy-2-phenylethyl]nitrous amide. InChIKey: URTRJVLUIFRIPB-INIZCTEOSA-N.
| Molecular formula | C16H19N3O2 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | N-[2-(4-aminophenyl)ethyl]-N-[(2R)-2-hydroxy-2-phenylethyl]nitrous amide |
| InChIKey | URTRJVLUIFRIPB-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](CN(CCC2=CC=C(C=C2)N)N=O)O |
Computed by PubChem (NCBI)