CAS 328548-73-8 is the registry number for 2-[(4-Ethoxyphenyl)amino]-4,6-dimethylnicotinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(4-ethoxyanilino)-4,6-dimethylpyridine-3-carboxamide (CAS 328548-73-8) is a chemical compound with the molecular formula C16H19N3O2 and a molecular weight of 285.34 g/mol. IUPAC name: 2-(4-ethoxyanilino)-4,6-dimethylpyridine-3-carboxamide. InChIKey: VIVIMYSTLCDLJU-UHFFFAOYSA-N.
| Molecular formula | C16H19N3O2 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | 2-(4-ethoxyanilino)-4,6-dimethylpyridine-3-carboxamide |
| InChIKey | VIVIMYSTLCDLJU-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)NC2=C(C(=CC(=N2)C)C)C(=O)N |
Computed by PubChem (NCBI)