CAS 1395493-13-6 is the registry number for tert-Butyl 1-phenyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1h)-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylate (CAS 1395493-13-6) is a chemical compound with the molecular formula C16H19N3O2 and a molecular weight of 285.34 g/mol. IUPAC name: tert-butyl 1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylate. InChIKey: FOMSEDUVLKLHPS-UHFFFAOYSA-N.
| Molecular formula | C16H19N3O2 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | tert-butyl 1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylate |
| InChIKey | FOMSEDUVLKLHPS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)N(N=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)