Products 2719031-79-3

CAS 2719031-79-3 is the registry number for Benzyl N-{3-[(pyridin-2-yl)amino]propyl}carbamate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

Benzyl N-[3-(pyridin-2-ylamino)propyl]carbamate (CAS 2719031-79-3) is a chemical compound with the molecular formula C16H19N3O2 and a molecular weight of 285.34 g/mol. IUPAC name: benzyl N-[3-(pyridin-2-ylamino)propyl]carbamate. InChIKey: OAAMYCLTZQNCKL-UHFFFAOYSA-N.

Identity
Molecular formulaC16H19N3O2
Molecular weight285.34 g/mol
IUPAC namebenzyl N-[3-(pyridin-2-ylamino)propyl]carbamate
InChIKeyOAAMYCLTZQNCKL-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)NCCCNC2=CC=CC=N2

Computed by PubChem (NCBI)